C22H29N3O3 — CID 141028210
prop-2-enyl N-[6-[3-(cyclohexylamino)propoxy]isoquinolin-1-yl]carbamate (PubChem CID 141028210) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is prop-2-enyl N-[6-[3-(cyclohexylamino)propoxy]isoquinolin-1-yl]carbamate.
| Compound Name | prop-2-enyl N-[6-[3-(cyclohexylamino)propoxy]isoquinolin-1-yl]carbamate |
|---|---|
| PubChem CID | 141028210 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | prop-2-enyl N-[6-[3-(cyclohexylamino)propoxy]isoquinolin-1-yl]carbamate |
| SMILES | C=CCOC(=O)Nc1nccc2cc(OCCCNC3CCCCC3)ccc12 |
| InChI | InChI=1S/C22H29N3O3/c1-2-14-28-22(26)25-21-20-10-9-19(16-17(20)11-13-24-21)27-15-6-12-23-18-7-4-3-5-8-18/h2,9-11,13,16,18,23H,1,3-8,12,14-15H2,(H,24,25,26) |
| InChIKey | NDBUVEFFTPVDKK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|