C36H54N4O5 — CID 20794976
(4S)-2-tert-butyl-4-(cyclooctylamino)-5-oxo-5-[2-[2-[1-(prop-2-enoxyamino)isoquinolin-6-yl]oxyethyl]piperidin-1-yl]pentanoic acid (PubChem CID 20794976) has the molecular formula C36H54N4O5 and a molecular weight of 622.85 g/mol. Its IUPAC name is (4S)-2-tert-butyl-4-(cyclooctylamino)-5-oxo-5-[2-[2-[1-(prop-2-enoxyamino)isoquinolin-6-yl]oxyethyl]piperidin-1-yl]pentanoic acid.
| Compound Name | (4S)-2-tert-butyl-4-(cyclooctylamino)-5-oxo-5-[2-[2-[1-(prop-2-enoxyamino)isoquinolin-6-yl]oxyethyl]piperidin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 20794976 |
| Molecular Formula | C36H54N4O5 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.41 |
| IUPAC Name | (4S)-2-tert-butyl-4-(cyclooctylamino)-5-oxo-5-[2-[2-[1-(prop-2-enoxyamino)isoquinolin-6-yl]oxyethyl]piperidin-1-yl]pentanoic acid |
| SMILES | C=CCONc1nccc2cc(OCCC3CCCCN3C(=O)[C@H](CC(C(=O)O)C(C)(C)C)NC3CCCCCCC3)ccc12 |
| InChI | InChI=1S/C36H54N4O5/c1-5-22-45-39-33-30-17-16-29(24-26(30)18-20-37-33)44-23-19-28-15-11-12-21-40(28)34(41)32(25-31(35(42)43)36(2,3)4)38-27-13-9-7-6-8-10-14-27/h5,16-18,20,24,27-28,31-32,38H,1,6-15,19,21-23,25H2,2-4H3,(H,37,39)(H,42,43)/t28?,31?,32-/m0/s1 |
| InChIKey | WIIMIGXXDBCXGK-NEQSDMGFSA-N |
| XLogP | 7.12 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|