C25H33N3O5 — CID 20794986
tert-butyl (2S)-2-[2-[1-(prop-2-enoxycarbonylamino)isoquinolin-6-yl]oxyethyl]piperidine-1-carboxylate (PubChem CID 20794986) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-[1-(prop-2-enoxycarbonylamino)isoquinolin-6-yl]oxyethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[2-[1-(prop-2-enoxycarbonylamino)isoquinolin-6-yl]oxyethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 20794986 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | tert-butyl (2S)-2-[2-[1-(prop-2-enoxycarbonylamino)isoquinolin-6-yl]oxyethyl]piperidine-1-carboxylate |
| SMILES | C=CCOC(=O)Nc1nccc2cc(OCC[C@@H]3CCCCN3C(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C25H33N3O5/c1-5-15-32-23(29)27-22-21-10-9-20(17-18(21)11-13-26-22)31-16-12-19-8-6-7-14-28(19)24(30)33-25(2,3)4/h5,9-11,13,17,19H,1,6-8,12,14-16H2,2-4H3,(H,26,27,29)/t19-/m0/s1 |
| InChIKey | ICOPANJRZVQARA-IBGZPJMESA-N |
| XLogP | 5.53 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|