C20H26O — CID 141030772
3-[(1E,3E)-3-methylpenta-1,3-dienyl]-2-pentyl-2H-chromene (PubChem CID 141030772) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-[(1E,3E)-3-methylpenta-1,3-dienyl]-2-pentyl-2H-chromene.
| Compound Name | 3-[(1E,3E)-3-methylpenta-1,3-dienyl]-2-pentyl-2H-chromene |
|---|---|
| PubChem CID | 141030772 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 3-[(1E,3E)-3-methylpenta-1,3-dienyl]-2-pentyl-2H-chromene |
| SMILES | C/C=C(C)/C=C/C1=Cc2ccccc2OC1CCCCC |
| InChI | InChI=1S/C20H26O/c1-4-6-7-11-20-18(14-13-16(3)5-2)15-17-10-8-9-12-19(17)21-20/h5,8-10,12-15,20H,4,6-7,11H2,1-3H3/b14-13+,16-5+ |
| InChIKey | MSLKOOSWHDVIRJ-NSIMVMACSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|