3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid

C24H32O3 — CID 72957807

IUPAC3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid
SMILESCCCCCCCCCC1Oc2ccccc2C=C1C=CC(C)=CC(=O)O
InChIInChI=1S/C24H32O3/c1-3-4-5-6-7-8-9-13-23-21(16-15-19(2)17-24(25)26)18-20-12-10-11-14-22(20)27-23/h10-12,14-18,23H,3-9,13H2,1-2H3,(H,25,26)
InChIKeyVHJDTQXMJMPNBW-UHFFFAOYSA-N
MW368.52 g/mol
LogP6.56
Rot. Bonds11

About 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid

3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid (PubChem CID 72957807) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid.

Molecular Properties

Compound Name3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid
PubChem CID72957807
Molecular FormulaC24H32O3
Molecular Weight368.52 g/mol
Exact Mass368.24
IUPAC Name3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid
SMILESCCCCCCCCCC1Oc2ccccc2C=C1C=CC(C)=CC(=O)O
InChIInChI=1S/C24H32O3/c1-3-4-5-6-7-8-9-13-23-21(16-15-19(2)17-24(25)26)18-20-12-10-11-14-22(20)27-23/h10-12,14-18,23H,3-9,13H2,1-2H3,(H,25,26)
InChIKeyVHJDTQXMJMPNBW-UHFFFAOYSA-N
XLogP6.56
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds11
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500368.52
LogP ≤ 56.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid?
The IUPAC name of 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid (CID 72957807) is 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid.
What is the SMILES notation for 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid?
The canonical SMILES for 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid is CCCCCCCCCC1Oc2ccccc2C=C1C=CC(C)=CC(=O)O.
What is the InChIKey of 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid?
The InChIKey is VHJDTQXMJMPNBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32O3/c1-3-4-5-6-7-8-9-13-23-21(16-15-19(2)17-24(25)26)18-20-12-10-11-14-22(20)27-23/h10-12,14-18,23H,3-9,13H2,1-2H3,(H,25,26).
What are the key properties of 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid?
3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid has a molecular weight of 368.52 g/mol, XLogP of 6.56, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid is sourced from PubChem (CID 72957807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).