C24H32O3 — CID 72957807
3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid (PubChem CID 72957807) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid.
| Compound Name | 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 72957807 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 3-methyl-5-(2-nonyl-2H-chromen-3-yl)penta-2,4-dienoic acid |
| SMILES | CCCCCCCCCC1Oc2ccccc2C=C1C=CC(C)=CC(=O)O |
| InChI | InChI=1S/C24H32O3/c1-3-4-5-6-7-8-9-13-23-21(16-15-19(2)17-24(25)26)18-20-12-10-11-14-22(20)27-23/h10-12,14-18,23H,3-9,13H2,1-2H3,(H,25,26) |
| InChIKey | VHJDTQXMJMPNBW-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|