C25H35NO2 — CID 21137847
(3E,5E)-4-methyl-6-[2-(nonylamino)-2H-chromen-3-yl]hexa-3,5-dien-2-one (PubChem CID 21137847) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is (3E,5E)-4-methyl-6-[2-(nonylamino)-2H-chromen-3-yl]hexa-3,5-dien-2-one.
| Compound Name | (3E,5E)-4-methyl-6-[2-(nonylamino)-2H-chromen-3-yl]hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 21137847 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | (3E,5E)-4-methyl-6-[2-(nonylamino)-2H-chromen-3-yl]hexa-3,5-dien-2-one |
| SMILES | CCCCCCCCCNC1Oc2ccccc2C=C1/C=C/C(C)=C/C(C)=O |
| InChI | InChI=1S/C25H35NO2/c1-4-5-6-7-8-9-12-17-26-25-23(16-15-20(2)18-21(3)27)19-22-13-10-11-14-24(22)28-25/h10-11,13-16,18-19,25-26H,4-9,12,17H2,1-3H3/b16-15+,20-18+ |
| InChIKey | HIGZSGVAGYGEPL-OCEQPANSSA-N |
| XLogP | 6.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|