C17H28Si — CID 141033993
1-cyclopropyl-3,3,4-tris(ethenyl)-1,2,2-trimethylsilinane (PubChem CID 141033993) has the molecular formula C17H28Si and a molecular weight of 260.50 g/mol. Its IUPAC name is 1-cyclopropyl-3,3,4-tris(ethenyl)-1,2,2-trimethylsilinane.
| Compound Name | 1-cyclopropyl-3,3,4-tris(ethenyl)-1,2,2-trimethylsilinane |
|---|---|
| PubChem CID | 141033993 |
| Molecular Formula | C17H28Si |
| Molecular Weight | 260.50 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 1-cyclopropyl-3,3,4-tris(ethenyl)-1,2,2-trimethylsilinane |
| SMILES | C=CC1CC[Si](C)(C2CC2)C(C)(C)C1(C=C)C=C |
| InChI | InChI=1S/C17H28Si/c1-7-14-12-13-18(6,15-10-11-15)16(4,5)17(14,8-2)9-3/h7-9,14-15H,1-3,10-13H2,4-6H3 |
| InChIKey | GRCDDYHRLVSJHX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|