C10H20Si — CID 14689185
[(1R,3R)-3-ethenyl-2,2-dimethylcyclopropyl]-trimethylsilane (PubChem CID 14689185) has the molecular formula C10H20Si and a molecular weight of 168.36 g/mol. Its IUPAC name is [(1R,3R)-3-ethenyl-2,2-dimethylcyclopropyl]-trimethylsilane.
| Compound Name | [(1R,3R)-3-ethenyl-2,2-dimethylcyclopropyl]-trimethylsilane |
|---|---|
| PubChem CID | 14689185 |
| Molecular Formula | C10H20Si |
| Molecular Weight | 168.36 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | [(1R,3R)-3-ethenyl-2,2-dimethylcyclopropyl]-trimethylsilane |
| SMILES | C=C[C@H]1[C@@H]([Si](C)(C)C)C1(C)C |
| InChI | InChI=1S/C10H20Si/c1-7-8-9(10(8,2)3)11(4,5)6/h7-9H,1H2,2-6H3/t8-,9+/m0/s1 |
| InChIKey | LNOLDFVCYXBMNV-DTWKUNHWSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|