C12H14ClN — CID 141035395
1-[2-(4-chlorophenyl)-2-methylcyclopropyl]ethanimine (PubChem CID 141035395) has the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-methylcyclopropyl]ethanimine.
| Compound Name | 1-[2-(4-chlorophenyl)-2-methylcyclopropyl]ethanimine |
|---|---|
| PubChem CID | 141035395 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-methylcyclopropyl]ethanimine |
| SMILES | [H]/N=C(\C)C1CC1(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClN/c1-8(14)11-7-12(11,2)9-3-5-10(13)6-4-9/h3-6,11,14H,7H2,1-2H3/b14-8+ |
| InChIKey | KNORIEXPVWRVIB-RIYZIHGNSA-N |
| XLogP | 3.66 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|