C20H21Cl2NO — CID 40565914
(1S)-N-tert-butyl-2,2-bis(4-chlorophenyl)cyclopropane-1-carboxamide (PubChem CID 40565914) has the molecular formula C20H21Cl2NO and a molecular weight of 362.30 g/mol. Its IUPAC name is (1S)-N-tert-butyl-2,2-bis(4-chlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | (1S)-N-tert-butyl-2,2-bis(4-chlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 40565914 |
| Molecular Formula | C20H21Cl2NO |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (1S)-N-tert-butyl-2,2-bis(4-chlorophenyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@H]1CC1(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21Cl2NO/c1-19(2,3)23-18(24)17-12-20(17,13-4-8-15(21)9-5-13)14-6-10-16(22)11-7-14/h4-11,17H,12H2,1-3H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | XHUWXJWHOZMXSB-QGZVFWFLSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |