C23H28O2 — CID 141035604
2-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzaldehyde (PubChem CID 141035604) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzaldehyde.
| Compound Name | 2-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 141035604 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzaldehyde |
| SMILES | COc1c(C=O)cccc1-c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H28O2/c1-15-12-19-20(23(4,5)11-10-22(19,2)3)13-18(15)17-9-7-8-16(14-24)21(17)25-6/h7-9,12-14H,10-11H2,1-6H3 |
| InChIKey | UBZGMHBMJYRSEP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|