C27H39NO2 — CID 142215384
acetaldehyde;ethane;[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methanimine (PubChem CID 142215384) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is acetaldehyde;ethane;[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methanimine.
| Compound Name | acetaldehyde;ethane;[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 142215384 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | acetaldehyde;ethane;[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methanimine |
| SMILES | CC.CC=O.[H]/N=C/c1ccc(OC)c(-c2cc3c(cc2C)C(C)(C)CCC3(C)C)c1 |
| InChI | InChI=1S/C23H29NO.C2H4O.C2H6/c1-15-11-19-20(23(4,5)10-9-22(19,2)3)13-17(15)18-12-16(14-24)7-8-21(18)25-6;1-2-3;1-2/h7-8,11-14,24H,9-10H2,1-6H3;2H,1H3;1-2H3/b24-14+;; |
| InChIKey | GNSFGKRFKKJUEH-IXADMPAPSA-N |
| XLogP | 7.25 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|