C22H27NO2 — CID 141035605
5-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)pyridine-2-carbaldehyde (PubChem CID 141035605) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 5-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)pyridine-2-carbaldehyde.
| Compound Name | 5-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 141035605 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 5-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)pyridine-2-carbaldehyde |
| SMILES | COc1cnc(C=O)c(-c2cc3c(cc2C)C(C)(C)CCC3(C)C)c1 |
| InChI | InChI=1S/C22H27NO2/c1-14-9-18-19(22(4,5)8-7-21(18,2)3)11-16(14)17-10-15(25-6)12-23-20(17)13-24/h9-13H,7-8H2,1-6H3 |
| InChIKey | RXTRURJZZWIKNQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|