C16H20N4S — CID 141039400
4,6-dimethyl-N-[[1-(4-methylphenyl)-2-methylsulfanylethylidene]amino]pyrimidin-2-amine (PubChem CID 141039400) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 4,6-dimethyl-N-[[1-(4-methylphenyl)-2-methylsulfanylethylidene]amino]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[[1-(4-methylphenyl)-2-methylsulfanylethylidene]amino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141039400 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4,6-dimethyl-N-[[1-(4-methylphenyl)-2-methylsulfanylethylidene]amino]pyrimidin-2-amine |
| SMILES | CSCC(=NNc1nc(C)cc(C)n1)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H20N4S/c1-11-5-7-14(8-6-11)15(10-21-4)19-20-16-17-12(2)9-13(3)18-16/h5-9H,10H2,1-4H3,(H,17,18,20) |
| InChIKey | IIQOFJUHRZBOGO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|