C45H26N14 — CID 141039501
4-naphthalen-1-yl-6-phthalazin-1-yl-2-(7H-purin-2-yl)-1-quinazolin-2-yl-7-quinoxalin-2-yl-2H-pteridine (PubChem CID 141039501) has the molecular formula C45H26N14 and a molecular weight of 762.80 g/mol. Its IUPAC name is 4-naphthalen-1-yl-6-phthalazin-1-yl-2-(7H-purin-2-yl)-1-quinazolin-2-yl-7-quinoxalin-2-yl-2H-pteridine.
| Compound Name | 4-naphthalen-1-yl-6-phthalazin-1-yl-2-(7H-purin-2-yl)-1-quinazolin-2-yl-7-quinoxalin-2-yl-2H-pteridine |
|---|---|
| PubChem CID | 141039501 |
| Molecular Formula | C45H26N14 |
| Molecular Weight | 762.80 g/mol |
| Exact Mass | 762.25 |
| IUPAC Name | 4-naphthalen-1-yl-6-phthalazin-1-yl-2-(7H-purin-2-yl)-1-quinazolin-2-yl-7-quinoxalin-2-yl-2H-pteridine |
| SMILES | c1ccc2nc(N3c4nc(-c5cnc6ccccc6n5)c(-c5nncc6ccccc56)nc4C(c4cccc5ccccc45)=NC3c3ncc4[nH]cnc4n3)ncc2c1 |
| InChI | InChI=1S/C45H26N14/c1-4-14-28-25(10-1)13-9-16-30(28)36-40-43(59(45-48-20-27-12-3-6-17-31(27)53-45)44(55-36)42-47-23-35-41(57-42)50-24-49-35)56-38(34-22-46-32-18-7-8-19-33(32)52-34)39(54-40)37-29-15-5-2-11-26(29)21-51-58-37/h1-24,44H,(H,47,49,50,57) |
| InChIKey | LCAFDKJUQHOBBF-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 173.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.80 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |