C23H44O6 — CID 141041792
4,5,5,6-tetramethyl-1,1,1,4-tetra(propan-2-yloxy)heptane-2,3-dione (PubChem CID 141041792) has the molecular formula C23H44O6 and a molecular weight of 416.60 g/mol. Its IUPAC name is 4,5,5,6-tetramethyl-1,1,1,4-tetra(propan-2-yloxy)heptane-2,3-dione.
| Compound Name | 4,5,5,6-tetramethyl-1,1,1,4-tetra(propan-2-yloxy)heptane-2,3-dione |
|---|---|
| PubChem CID | 141041792 |
| Molecular Formula | C23H44O6 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | 4,5,5,6-tetramethyl-1,1,1,4-tetra(propan-2-yloxy)heptane-2,3-dione |
| SMILES | CC(C)OC(OC(C)C)(OC(C)C)C(=O)C(=O)C(C)(OC(C)C)C(C)(C)C(C)C |
| InChI | InChI=1S/C23H44O6/c1-14(2)21(11,12)22(13,26-15(3)4)19(24)20(25)23(27-16(5)6,28-17(7)8)29-18(9)10/h14-18H,1-13H3 |
| InChIKey | BHTRTIZXGGSDLV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|