C10H14N2O2 — CID 141042921
5-(cyclohexylmethyl)imidazole-2,4-dione (PubChem CID 141042921) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)imidazole-2,4-dione.
| Compound Name | 5-(cyclohexylmethyl)imidazole-2,4-dione |
|---|---|
| PubChem CID | 141042921 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 5-(cyclohexylmethyl)imidazole-2,4-dione |
| SMILES | O=C1N=C(CC2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C10H14N2O2/c13-9-8(11-10(14)12-9)6-7-4-2-1-3-5-7/h7H,1-6H2,(H,12,13,14) |
| InChIKey | NCYHCTKYEWEPBT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |