C12H21N — CID 143711059
3-(cyclohexylmethyl)-2,2-dimethyl-1H-azete (PubChem CID 143711059) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-2,2-dimethyl-1H-azete.
| Compound Name | 3-(cyclohexylmethyl)-2,2-dimethyl-1H-azete |
|---|---|
| PubChem CID | 143711059 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 3-(cyclohexylmethyl)-2,2-dimethyl-1H-azete |
| SMILES | CC1(C)NC=C1CC1CCCCC1 |
| InChI | InChI=1S/C12H21N/c1-12(2)11(9-13-12)8-10-6-4-3-5-7-10/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | HIBGLTJABXRJLL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |