C18H21N5O2 — CID 141044002
N-(3-nitrophenyl)-8-pentan-3-yl-7H-pyrido[2,3-d]pyrimidin-2-amine (PubChem CID 141044002) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-(3-nitrophenyl)-8-pentan-3-yl-7H-pyrido[2,3-d]pyrimidin-2-amine.
| Compound Name | N-(3-nitrophenyl)-8-pentan-3-yl-7H-pyrido[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141044002 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-(3-nitrophenyl)-8-pentan-3-yl-7H-pyrido[2,3-d]pyrimidin-2-amine |
| SMILES | CCC(CC)N1CC=Cc2cnc(Nc3cccc([N+](=O)[O-])c3)nc21 |
| InChI | InChI=1S/C18H21N5O2/c1-3-15(4-2)22-10-6-7-13-12-19-18(21-17(13)22)20-14-8-5-9-16(11-14)23(24)25/h5-9,11-12,15H,3-4,10H2,1-2H3,(H,19,20,21) |
| InChIKey | DNUIRZJQOIXTQX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|