C18H20N4 — CID 70114677
8-(3-methylbut-2-enyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine (PubChem CID 70114677) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 8-(3-methylbut-2-enyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine.
| Compound Name | 8-(3-methylbut-2-enyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 70114677 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 8-(3-methylbut-2-enyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine |
| SMILES | CC(C)=CCN1CC=Cc2cnc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C18H20N4/c1-14(2)10-12-22-11-6-7-15-13-19-18(21-17(15)22)20-16-8-4-3-5-9-16/h3-10,13H,11-12H2,1-2H3,(H,19,20,21) |
| InChIKey | ZXQYEFGPOUXDFJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|