C22H22N4O — CID 70111674
8-(3-phenoxypropyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine (PubChem CID 70111674) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 8-(3-phenoxypropyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine.
| Compound Name | 8-(3-phenoxypropyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 70111674 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 8-(3-phenoxypropyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine |
| SMILES | C1=Cc2cnc(Nc3ccccc3)nc2N(CCCOc2ccccc2)C1 |
| InChI | InChI=1S/C22H22N4O/c1-3-10-19(11-4-1)24-22-23-17-18-9-7-14-26(21(18)25-22)15-8-16-27-20-12-5-2-6-13-20/h1-7,9-13,17H,8,14-16H2,(H,23,24,25) |
| InChIKey | UABWYINDNOEMHI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|