C16H13F5N4 — CID 141043897
8-(2,2,3,3,3-pentafluoropropyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine (PubChem CID 141043897) has the molecular formula C16H13F5N4 and a molecular weight of 356.30 g/mol. Its IUPAC name is 8-(2,2,3,3,3-pentafluoropropyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine.
| Compound Name | 8-(2,2,3,3,3-pentafluoropropyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141043897 |
| Molecular Formula | C16H13F5N4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 8-(2,2,3,3,3-pentafluoropropyl)-N-phenyl-7H-pyrido[2,3-d]pyrimidin-2-amine |
| SMILES | FC(F)(F)C(F)(F)CN1CC=Cc2cnc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C16H13F5N4/c17-15(18,16(19,20)21)10-25-8-4-5-11-9-22-14(24-13(11)25)23-12-6-2-1-3-7-12/h1-7,9H,8,10H2,(H,22,23,24) |
| InChIKey | IYRFTIIKIUPCCU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|