C18H20F2N4 — CID 141043875
N-(3,5-difluorophenyl)-8-pentan-3-yl-7H-pyrido[2,3-d]pyrimidin-2-amine (PubChem CID 141043875) has the molecular formula C18H20F2N4 and a molecular weight of 330.38 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-8-pentan-3-yl-7H-pyrido[2,3-d]pyrimidin-2-amine.
| Compound Name | N-(3,5-difluorophenyl)-8-pentan-3-yl-7H-pyrido[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141043875 |
| Molecular Formula | C18H20F2N4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-(3,5-difluorophenyl)-8-pentan-3-yl-7H-pyrido[2,3-d]pyrimidin-2-amine |
| SMILES | CCC(CC)N1CC=Cc2cnc(Nc3cc(F)cc(F)c3)nc21 |
| InChI | InChI=1S/C18H20F2N4/c1-3-16(4-2)24-7-5-6-12-11-21-18(23-17(12)24)22-15-9-13(19)8-14(20)10-15/h5-6,8-11,16H,3-4,7H2,1-2H3,(H,21,22,23) |
| InChIKey | VVZLTVZHHSDAAY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |