About bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone
bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone (PubChem CID 141044550) has the molecular formula C17H22N4OS2
and a molecular weight of 362.52 g/mol. Its IUPAC name is bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone.
Molecular Properties
| Compound Name | bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone |
| PubChem CID | 141044550 |
| Molecular Formula | C17H22N4OS2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone |
| SMILES | O=C(c1csc(CN2CCCC2)n1)c1csc(CN2CCCC2)n1 |
| InChI | InChI=1S/C17H22N4OS2/c22-17(13-11-23-15(18-13)9-20-5-1-2-6-20)14-12-24-16(19-14)10-21-7-3-4-8-21/h11-12H,1-10H2 |
| InChIKey | ZRHMLTNRFIDTGE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone?
The IUPAC name of bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone (CID 141044550) is bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone.
What is the SMILES notation for bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone?
The canonical SMILES for bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone is O=C(c1csc(CN2CCCC2)n1)c1csc(CN2CCCC2)n1.
What is the InChIKey of bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone?
The InChIKey is ZRHMLTNRFIDTGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4OS2/c22-17(13-11-23-15(18-13)9-20-5-1-2-6-20)14-12-24-16(19-14)10-21-7-3-4-8-21/h11-12H,1-10H2.
What are the key properties of bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone?
bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone has a molecular weight of 362.52 g/mol, XLogP of 3.02, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-4-yl]methanone is sourced from PubChem (CID 141044550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).