C10H6N2 — CID 141050593
7,8-diazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaene (PubChem CID 141050593) has the molecular formula C10H6N2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 7,8-diazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaene.
| Compound Name | 7,8-diazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 141050593 |
| Molecular Formula | C10H6N2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 7,8-diazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaene |
| SMILES | C1=Cc2c3c(nnc2=C1)=CC=C3 |
| InChI | InChI=1S/C10H6N2/c1-3-7-8-4-2-6-10(8)12-11-9(7)5-1/h1-6H |
| InChIKey | RJKWPKRHAQALNC-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |