About cyclopenta[f]indazole
cyclopenta[f]indazole (PubChem CID 22352967) has the molecular formula C10H6N2
and a molecular weight of 154.17 g/mol. Its IUPAC name is cyclopenta[f]indazole.
Molecular Properties
| Compound Name | cyclopenta[f]indazole |
| PubChem CID | 22352967 |
| Molecular Formula | C10H6N2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | cyclopenta[f]indazole |
| SMILES | C1=Cc2cc3c(cc2=C1)N=NC=3 |
| InChI | InChI=1S/C10H6N2/c1-2-7-4-9-6-11-12-10(9)5-8(7)3-1/h1-6H |
| InChIKey | FXKHIMPBOCLMFP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenta[f]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[f]indazole?
The IUPAC name of cyclopenta[f]indazole (CID 22352967) is cyclopenta[f]indazole.
What is the SMILES notation for cyclopenta[f]indazole?
The canonical SMILES for cyclopenta[f]indazole is C1=Cc2cc3c(cc2=C1)N=NC=3.
What is the InChIKey of cyclopenta[f]indazole?
The InChIKey is FXKHIMPBOCLMFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2/c1-2-7-4-9-6-11-12-10(9)5-8(7)3-1/h1-6H.
What are the key properties of cyclopenta[f]indazole?
cyclopenta[f]indazole has a molecular weight of 154.17 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[f]indazole is sourced from PubChem (CID 22352967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).