C6H10N2OS2 — CID 141055281
2-(4-methyl-2-sulfanyl-2H-1,3-thiazol-3-yl)acetamide (PubChem CID 141055281) has the molecular formula C6H10N2OS2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-(4-methyl-2-sulfanyl-2H-1,3-thiazol-3-yl)acetamide.
| Compound Name | 2-(4-methyl-2-sulfanyl-2H-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 141055281 |
| Molecular Formula | C6H10N2OS2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 2-(4-methyl-2-sulfanyl-2H-1,3-thiazol-3-yl)acetamide |
| SMILES | CC1=CSC(S)N1CC(N)=O |
| InChI | InChI=1S/C6H10N2OS2/c1-4-3-11-6(10)8(4)2-5(7)9/h3,6,10H,2H2,1H3,(H2,7,9) |
| InChIKey | GWNDKEQOXNTZLA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|