C12H16S — CID 141056299
4,5,8-trimethyl-3,4-dihydro-2H-thiochromene (PubChem CID 141056299) has the molecular formula C12H16S and a molecular weight of 192.33 g/mol. Its IUPAC name is 4,5,8-trimethyl-3,4-dihydro-2H-thiochromene.
| Compound Name | 4,5,8-trimethyl-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 141056299 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 4,5,8-trimethyl-3,4-dihydro-2H-thiochromene |
| SMILES | Cc1ccc(C)c2c1SCCC2C |
| InChI | InChI=1S/C12H16S/c1-8-4-5-10(3)12-11(8)9(2)6-7-13-12/h4-5,9H,6-7H2,1-3H3 |
| InChIKey | ZWUJDFTYXZVZNI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |