C24H46N4 — CID 141057325
N,N'-bis(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)hexane-1,6-diamine (PubChem CID 141057325) has the molecular formula C24H46N4 and a molecular weight of 390.66 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 141057325 |
| Molecular Formula | C24H46N4 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.37 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)hexane-1,6-diamine |
| SMILES | CC1(C)C=C(NCCCCCCNC2=CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C24H46N4/c1-21(2)15-19(16-22(3,4)27-21)25-13-11-9-10-12-14-26-20-17-23(5,6)28-24(7,8)18-20/h15,17,25-28H,9-14,16,18H2,1-8H3 |
| InChIKey | QMXHGJAGNDIOLV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|