C15H31N3 — CID 140985778
1-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)hexane-1,6-diamine (PubChem CID 140985778) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 1-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)hexane-1,6-diamine.
| Compound Name | 1-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 140985778 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 1-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)hexane-1,6-diamine |
| SMILES | CC1(C)C=C(C(N)CCCCCN)CC(C)(C)N1 |
| InChI | InChI=1S/C15H31N3/c1-14(2)10-12(11-15(3,4)18-14)13(17)8-6-5-7-9-16/h10,13,18H,5-9,11,16-17H2,1-4H3 |
| InChIKey | QNPZLLSCXWFUJK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|