C9H18Cl2N4 — CID 141058423
4,5-dihydro-1H-imidazol-1-ium;1-ethenyl-1-methyl-4,5-dihydroimidazol-1-ium;dichloride (PubChem CID 141058423) has the molecular formula C9H18Cl2N4 and a molecular weight of 253.18 g/mol. Its IUPAC name is 4,5-dihydro-1H-imidazol-1-ium;1-ethenyl-1-methyl-4,5-dihydroimidazol-1-ium;dichloride.
| Compound Name | 4,5-dihydro-1H-imidazol-1-ium;1-ethenyl-1-methyl-4,5-dihydroimidazol-1-ium;dichloride |
|---|---|
| PubChem CID | 141058423 |
| Molecular Formula | C9H18Cl2N4 |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4,5-dihydro-1H-imidazol-1-ium;1-ethenyl-1-methyl-4,5-dihydroimidazol-1-ium;dichloride |
| SMILES | C1=NCC[NH2+]1.C=C[N+]1(C)C=NCC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C6H11N2.C3H6N2.2ClH/c1-3-8(2)5-4-7-6-8;1-2-5-3-4-1;;/h3,6H,1,4-5H2,2H3;3H,1-2H2,(H,4,5);2*1H/q+1;;;/p-1 |
| InChIKey | KVQAAAHBJYNZLD-UHFFFAOYSA-M |
| XLogP | -6.78 |
| TPSA | 41.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | -6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|