C9H18N4 — CID 163900004
2-ethenyl-1-ethyl-1-[2-(methylamino)ethyl]-3-methylideneguanidine (PubChem CID 163900004) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-ethenyl-1-ethyl-1-[2-(methylamino)ethyl]-3-methylideneguanidine.
| Compound Name | 2-ethenyl-1-ethyl-1-[2-(methylamino)ethyl]-3-methylideneguanidine |
|---|---|
| PubChem CID | 163900004 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2-ethenyl-1-ethyl-1-[2-(methylamino)ethyl]-3-methylideneguanidine |
| SMILES | C=C/N=C(\N=C)N(CC)CCNC |
| InChI | InChI=1S/C9H18N4/c1-5-12-9(11-4)13(6-2)8-7-10-3/h5,10H,1,4,6-8H2,2-3H3/b12-9+ |
| InChIKey | QIZCQMPNXSZSNU-FMIVXFBMSA-N |
| XLogP | 0.73 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|