C12H20N2 — CID 143497536
N'-ethyl-N'-[(3Z)-hepta-1,3-dien-5-yn-2-yl]-N-methylethane-1,2-diamine (PubChem CID 143497536) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N'-ethyl-N'-[(3Z)-hepta-1,3-dien-5-yn-2-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-[(3Z)-hepta-1,3-dien-5-yn-2-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 143497536 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N'-ethyl-N'-[(3Z)-hepta-1,3-dien-5-yn-2-yl]-N-methylethane-1,2-diamine |
| SMILES | C=C(/C=C\C#CC)N(CC)CCNC |
| InChI | InChI=1S/C12H20N2/c1-5-7-8-9-12(3)14(6-2)11-10-13-4/h8-9,13H,3,6,10-11H2,1-2,4H3/b9-8- |
| InChIKey | FWQCCLINXMBUDG-HJWRWDBZSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|