About triethoxyalumane
triethoxyalumane (PubChem CID 141061757) has the molecular formula C18H45Al3O9
and a molecular weight of 486.50 g/mol. Its IUPAC name is triethoxyalumane.
Molecular Properties
| Compound Name | triethoxyalumane |
| PubChem CID | 141061757 |
| Molecular Formula | C18H45Al3O9 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | triethoxyalumane |
| SMILES | CCO[Al](OCC)OCC.CCO[Al](OCC)OCC.CCO[Al](OCC)OCC |
| InChI | InChI=1S/9C2H5O.3Al/c9*1-2-3;;;/h9*2H2,1H3;;;/q9*-1;3*+3 |
| InChIKey | PULINHUZDHPFQT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze triethoxyalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxyalumane?
The IUPAC name of triethoxyalumane (CID 141061757) is triethoxyalumane.
What is the SMILES notation for triethoxyalumane?
The canonical SMILES for triethoxyalumane is CCO[Al](OCC)OCC.CCO[Al](OCC)OCC.CCO[Al](OCC)OCC.
What is the InChIKey of triethoxyalumane?
The InChIKey is PULINHUZDHPFQT-UHFFFAOYSA-N. The full InChI is InChI=1S/9C2H5O.3Al/c9*1-2-3;;;/h9*2H2,1H3;;;/q9*-1;3*+3.
What are the key properties of triethoxyalumane?
triethoxyalumane has a molecular weight of 486.50 g/mol, XLogP of 3.24, 18 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxyalumane is sourced from PubChem (CID 141061757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).