About propan-2-ol;tripropoxyalumane
propan-2-ol;tripropoxyalumane (PubChem CID 159839626) has the molecular formula C12H29AlO4
and a molecular weight of 264.34 g/mol. Its IUPAC name is propan-2-ol;tripropoxyalumane.
Molecular Properties
| Compound Name | propan-2-ol;tripropoxyalumane |
| PubChem CID | 159839626 |
| Molecular Formula | C12H29AlO4 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | propan-2-ol;tripropoxyalumane |
| SMILES | CC(C)O.CCCO[Al](OCCC)OCCC |
| InChI | InChI=1S/C3H8O.3C3H7O.Al/c1-3(2)4;3*1-2-3-4;/h3-4H,1-2H3;3*2-3H2,1H3;/q;3*-1;+3 |
| InChIKey | NONAGSYFYNRJGW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-ol;tripropoxyalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;tripropoxyalumane?
The IUPAC name of propan-2-ol;tripropoxyalumane (CID 159839626) is propan-2-ol;tripropoxyalumane.
What is the SMILES notation for propan-2-ol;tripropoxyalumane?
The canonical SMILES for propan-2-ol;tripropoxyalumane is CC(C)O.CCCO[Al](OCCC)OCCC.
What is the InChIKey of propan-2-ol;tripropoxyalumane?
The InChIKey is NONAGSYFYNRJGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.3C3H7O.Al/c1-3(2)4;3*1-2-3-4;/h3-4H,1-2H3;3*2-3H2,1H3;/q;3*-1;+3.
What are the key properties of propan-2-ol;tripropoxyalumane?
propan-2-ol;tripropoxyalumane has a molecular weight of 264.34 g/mol, XLogP of 2.64, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;tripropoxyalumane is sourced from PubChem (CID 159839626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).