C13H31AlN2O5 — CID 175292925
4-[3-aminopropoxy(ethoxy)alumanyl]oxy-4,4-diethoxybutan-1-amine (PubChem CID 175292925) has the molecular formula C13H31AlN2O5 and a molecular weight of 322.38 g/mol. Its IUPAC name is 4-[3-aminopropoxy(ethoxy)alumanyl]oxy-4,4-diethoxybutan-1-amine.
| Compound Name | 4-[3-aminopropoxy(ethoxy)alumanyl]oxy-4,4-diethoxybutan-1-amine |
|---|---|
| PubChem CID | 175292925 |
| Molecular Formula | C13H31AlN2O5 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 4-[3-aminopropoxy(ethoxy)alumanyl]oxy-4,4-diethoxybutan-1-amine |
| SMILES | CCO[Al](OCCCN)OC(CCCN)(OCC)OCC |
| InChI | InChI=1S/C8H18NO3.C3H8NO.C2H5O.Al/c1-3-11-8(10,12-4-2)6-5-7-9;4-2-1-3-5;1-2-3;/h3-7,9H2,1-2H3;1-4H2;2H2,1H3;/q3*-1;+3 |
| InChIKey | DGRPSRIOGIHVKP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|