About CID 152606157
CID 152606157 (PubChem CID 152606157) has the molecular formula C13H30NO5Si
and a molecular weight of 308.47 g/mol.
Molecular Properties
| Compound Name | CID 152606157 |
| PubChem CID | 152606157 |
| Molecular Formula | C13H30NO5Si |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | — |
| SMILES | CCO[Si](CCCN)OCC(OCC)(OCC)OCC |
| InChI | InChI=1S/C13H30NO5Si/c1-5-15-13(16-6-2,17-7-3)12-19-20(18-8-4)11-9-10-14/h5-12,14H2,1-4H3 |
| InChIKey | YYNZKBLHWUQRKB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 152606157 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 152606157?
The IUPAC name of CID 152606157 (CID 152606157) is not available.
What is the SMILES notation for CID 152606157?
The canonical SMILES for CID 152606157 is CCO[Si](CCCN)OCC(OCC)(OCC)OCC.
What is the InChIKey of CID 152606157?
The InChIKey is YYNZKBLHWUQRKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30NO5Si/c1-5-15-13(16-6-2,17-7-3)12-19-20(18-8-4)11-9-10-14/h5-12,14H2,1-4H3.
What are the key properties of CID 152606157?
CID 152606157 has a molecular weight of 308.47 g/mol, XLogP of 1.64, 14 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 152606157 is sourced from PubChem (CID 152606157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).