C14H34N2O5Si — CID 175274669
N'-[3-(1,1,2-triethoxyethoxymethoxysilyl)propyl]ethane-1,2-diamine (PubChem CID 175274669) has the molecular formula C14H34N2O5Si and a molecular weight of 338.52 g/mol. Its IUPAC name is N'-[3-(1,1,2-triethoxyethoxymethoxysilyl)propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-(1,1,2-triethoxyethoxymethoxysilyl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 175274669 |
| Molecular Formula | C14H34N2O5Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N'-[3-(1,1,2-triethoxyethoxymethoxysilyl)propyl]ethane-1,2-diamine |
| SMILES | CCOCC(OCC)(OCC)OCO[SiH2]CCCNCCN |
| InChI | InChI=1S/C14H34N2O5Si/c1-4-17-12-14(18-5-2,19-6-3)20-13-21-22-11-7-9-16-10-8-15/h16H,4-13,15,22H2,1-3H3 |
| InChIKey | IYVBLLROZRBIMX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|