C28H64N2O8Si2 — CID 172843842
N,N'-bis[6-(2,2,2-trimethoxyethoxysilyl)hexyl]hexane-1,6-diamine (PubChem CID 172843842) has the molecular formula C28H64N2O8Si2 and a molecular weight of 613.00 g/mol. Its IUPAC name is N,N'-bis[6-(2,2,2-trimethoxyethoxysilyl)hexyl]hexane-1,6-diamine.
| Compound Name | N,N'-bis[6-(2,2,2-trimethoxyethoxysilyl)hexyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 172843842 |
| Molecular Formula | C28H64N2O8Si2 |
| Molecular Weight | 613.00 g/mol |
| Exact Mass | 612.42 |
| IUPAC Name | N,N'-bis[6-(2,2,2-trimethoxyethoxysilyl)hexyl]hexane-1,6-diamine |
| SMILES | COC(CO[SiH2]CCCCCCNCCCCCCNCCCCCC[SiH2]OCC(OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C28H64N2O8Si2/c1-31-27(32-2,33-3)25-37-39-23-17-11-9-15-21-29-19-13-7-8-14-20-30-22-16-10-12-18-24-40-38-26-28(34-4,35-5)36-6/h29-30H,7-26,39-40H2,1-6H3 |
| InChIKey | XDOHDSBXJGMUKQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.00 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|