C13H28O5Si — CID 141063946
1-(2,4-dimethyl-1,3-dioxolan-2-yl)ethoxy-diethoxy-ethylsilane (PubChem CID 141063946) has the molecular formula C13H28O5Si and a molecular weight of 292.45 g/mol. Its IUPAC name is 1-(2,4-dimethyl-1,3-dioxolan-2-yl)ethoxy-diethoxy-ethylsilane.
| Compound Name | 1-(2,4-dimethyl-1,3-dioxolan-2-yl)ethoxy-diethoxy-ethylsilane |
|---|---|
| PubChem CID | 141063946 |
| Molecular Formula | C13H28O5Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1-(2,4-dimethyl-1,3-dioxolan-2-yl)ethoxy-diethoxy-ethylsilane |
| SMILES | CCO[Si](CC)(OCC)OC(C)C1(C)OCC(C)O1 |
| InChI | InChI=1S/C13H28O5Si/c1-7-15-19(9-3,16-8-2)18-12(5)13(6)14-10-11(4)17-13/h11-12H,7-10H2,1-6H3 |
| InChIKey | BSXDQPGOISNVHP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|