C8H16O2S — CID 147288645
1-(2,4-dimethyl-1,3-dioxolan-2-yl)propane-1-thiol (PubChem CID 147288645) has the molecular formula C8H16O2S and a molecular weight of 176.28 g/mol. Its IUPAC name is 1-(2,4-dimethyl-1,3-dioxolan-2-yl)propane-1-thiol.
| Compound Name | 1-(2,4-dimethyl-1,3-dioxolan-2-yl)propane-1-thiol |
|---|---|
| PubChem CID | 147288645 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1-(2,4-dimethyl-1,3-dioxolan-2-yl)propane-1-thiol |
| SMILES | CCC(S)C1(C)OCC(C)O1 |
| InChI | InChI=1S/C8H16O2S/c1-4-7(11)8(3)9-5-6(2)10-8/h6-7,11H,4-5H2,1-3H3 |
| InChIKey | CTSZBLWTNCMCLT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|