C17H25N — CID 141066942
1,4,4-trimethyl-7-pent-1-en-3-yl-2,3-dihydroquinoline (PubChem CID 141066942) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 1,4,4-trimethyl-7-pent-1-en-3-yl-2,3-dihydroquinoline.
| Compound Name | 1,4,4-trimethyl-7-pent-1-en-3-yl-2,3-dihydroquinoline |
|---|---|
| PubChem CID | 141066942 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 1,4,4-trimethyl-7-pent-1-en-3-yl-2,3-dihydroquinoline |
| SMILES | C=CC(CC)c1ccc2c(c1)N(C)CCC2(C)C |
| InChI | InChI=1S/C17H25N/c1-6-13(7-2)14-8-9-15-16(12-14)18(5)11-10-17(15,3)4/h6,8-9,12-13H,1,7,10-11H2,2-5H3 |
| InChIKey | MSHDUEIOLOMJQO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|