C15H23N — CID 58893584
1,4,4-trimethyl-6-propan-2-yl-2,3-dihydroquinoline (PubChem CID 58893584) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1,4,4-trimethyl-6-propan-2-yl-2,3-dihydroquinoline.
| Compound Name | 1,4,4-trimethyl-6-propan-2-yl-2,3-dihydroquinoline |
|---|---|
| PubChem CID | 58893584 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1,4,4-trimethyl-6-propan-2-yl-2,3-dihydroquinoline |
| SMILES | CC(C)c1ccc2c(c1)C(C)(C)CCN2C |
| InChI | InChI=1S/C15H23N/c1-11(2)12-6-7-14-13(10-12)15(3,4)8-9-16(14)5/h6-7,10-11H,8-9H2,1-5H3 |
| InChIKey | TXSIDGZOWUXOFQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |