C26H32N2 — CID 141067556
N-[[2-(2-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]-2,6-di(propan-2-yl)aniline (PubChem CID 141067556) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is N-[[2-(2-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[[2-(2-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 141067556 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | N-[[2-(2-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]-2,6-di(propan-2-yl)aniline |
| SMILES | CC1=CC=CC1CC(=NNc1c(C(C)C)cccc1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H32N2/c1-18(2)23-15-10-16-24(19(3)4)26(23)28-27-25(21-12-7-6-8-13-21)17-22-14-9-11-20(22)5/h6-16,18-19,22,28H,17H2,1-5H3 |
| InChIKey | KMXNFYOJZVMVBR-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|