C20H17F2NO4 — CID 141067667
(2S,4S)-4-[(2,4-difluorophenyl)methyl]-2-isocyano-5-oxo-5-phenylmethoxypentanoic acid (PubChem CID 141067667) has the molecular formula C20H17F2NO4 and a molecular weight of 373.36 g/mol. Its IUPAC name is (2S,4S)-4-[(2,4-difluorophenyl)methyl]-2-isocyano-5-oxo-5-phenylmethoxypentanoic acid.
| Compound Name | (2S,4S)-4-[(2,4-difluorophenyl)methyl]-2-isocyano-5-oxo-5-phenylmethoxypentanoic acid |
|---|---|
| PubChem CID | 141067667 |
| Molecular Formula | C20H17F2NO4 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (2S,4S)-4-[(2,4-difluorophenyl)methyl]-2-isocyano-5-oxo-5-phenylmethoxypentanoic acid |
| SMILES | [C-]#[N+][C@@H](C[C@H](Cc1ccc(F)cc1F)C(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H17F2NO4/c1-23-18(19(24)25)10-15(9-14-7-8-16(21)11-17(14)22)20(26)27-12-13-5-3-2-4-6-13/h2-8,11,15,18H,9-10,12H2,(H,24,25)/t15-,18-/m0/s1 |
| InChIKey | XUGJDHXWLMFGCU-YJBOKZPZSA-N |
| XLogP | 3.63 |
| TPSA | 67.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|