C21H23F2NO4 — CID 141460844
(2R,3R)-2-[2-(2,4-difluorophenyl)ethyl]-3-(phenylmethoxycarbamoyl)pentanoic acid (PubChem CID 141460844) has the molecular formula C21H23F2NO4 and a molecular weight of 391.41 g/mol. Its IUPAC name is (2R,3R)-2-[2-(2,4-difluorophenyl)ethyl]-3-(phenylmethoxycarbamoyl)pentanoic acid.
| Compound Name | (2R,3R)-2-[2-(2,4-difluorophenyl)ethyl]-3-(phenylmethoxycarbamoyl)pentanoic acid |
|---|---|
| PubChem CID | 141460844 |
| Molecular Formula | C21H23F2NO4 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (2R,3R)-2-[2-(2,4-difluorophenyl)ethyl]-3-(phenylmethoxycarbamoyl)pentanoic acid |
| SMILES | CC[C@@H](C(=O)NOCc1ccccc1)C(CCc1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C21H23F2NO4/c1-2-17(20(25)24-28-13-14-6-4-3-5-7-14)18(21(26)27)11-9-15-8-10-16(22)12-19(15)23/h3-8,10,12,17-18H,2,9,11,13H2,1H3,(H,24,25)(H,26,27)/t17-,18?/m1/s1 |
| InChIKey | QAANFSROKXSKFQ-QNSVNVJESA-N |
| XLogP | 3.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|