C14H5Br4NO2 — CID 141070120
2,4,5,6-tetrabromo-7-phenylisoindole-1,3-dione (PubChem CID 141070120) has the molecular formula C14H5Br4NO2 and a molecular weight of 538.82 g/mol. Its IUPAC name is 2,4,5,6-tetrabromo-7-phenylisoindole-1,3-dione.
| Compound Name | 2,4,5,6-tetrabromo-7-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 141070120 |
| Molecular Formula | C14H5Br4NO2 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 534.71 |
| IUPAC Name | 2,4,5,6-tetrabromo-7-phenylisoindole-1,3-dione |
| SMILES | O=C1c2c(Br)c(Br)c(Br)c(-c3ccccc3)c2C(=O)N1Br |
| InChI | InChI=1S/C14H5Br4NO2/c15-10-7(6-4-2-1-3-5-6)8-9(11(16)12(10)17)14(21)19(18)13(8)20/h1-5H |
| InChIKey | XZKJQHPOIXBFFO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|