C18H21Cl2N5O2 — CID 141071230
[7,8-dichloro-4-(3-morpholin-4-ylpropylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol (PubChem CID 141071230) has the molecular formula C18H21Cl2N5O2 and a molecular weight of 410.31 g/mol. Its IUPAC name is [7,8-dichloro-4-(3-morpholin-4-ylpropylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol.
| Compound Name | [7,8-dichloro-4-(3-morpholin-4-ylpropylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol |
|---|---|
| PubChem CID | 141071230 |
| Molecular Formula | C18H21Cl2N5O2 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [7,8-dichloro-4-(3-morpholin-4-ylpropylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol |
| SMILES | OCc1cnc2c(NCCCN3CCOCC3)nc3cc(Cl)c(Cl)cc3n12 |
| InChI | InChI=1S/C18H21Cl2N5O2/c19-13-8-15-16(9-14(13)20)25-12(11-26)10-22-18(25)17(23-15)21-2-1-3-24-4-6-27-7-5-24/h8-10,26H,1-7,11H2,(H,21,23) |
| InChIKey | MLBHLWNLHAQGAG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|