C19H23BrN2O2 — CID 141071516
4-[(E)-2-bromo-3-(2,5-dimethoxyphenyl)prop-2-enyl]-2-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 141071516) has the molecular formula C19H23BrN2O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 4-[(E)-2-bromo-3-(2,5-dimethoxyphenyl)prop-2-enyl]-2-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 4-[(E)-2-bromo-3-(2,5-dimethoxyphenyl)prop-2-enyl]-2-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 141071516 |
| Molecular Formula | C19H23BrN2O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 4-[(E)-2-bromo-3-(2,5-dimethoxyphenyl)prop-2-enyl]-2-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | COc1ccc(OC)c(/C=C(/Br)Cc2ccc(N)c(N(C)C)c2)c1 |
| InChI | InChI=1S/C19H23BrN2O2/c1-22(2)18-10-13(5-7-17(18)21)9-15(20)11-14-12-16(23-3)6-8-19(14)24-4/h5-8,10-12H,9,21H2,1-4H3/b15-11+ |
| InChIKey | OLWZJDLIIFKISW-RVDMUPIBSA-N |
| XLogP | 4.33 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|