C12H18N6O5 — CID 141074977
(2R)-2,5-diamino-2,3-bis(2-aminoacetyl)-3-(1H-imidazol-5-yl)-4-oxopentanoic acid (PubChem CID 141074977) has the molecular formula C12H18N6O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is (2R)-2,5-diamino-2,3-bis(2-aminoacetyl)-3-(1H-imidazol-5-yl)-4-oxopentanoic acid.
| Compound Name | (2R)-2,5-diamino-2,3-bis(2-aminoacetyl)-3-(1H-imidazol-5-yl)-4-oxopentanoic acid |
|---|---|
| PubChem CID | 141074977 |
| Molecular Formula | C12H18N6O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2R)-2,5-diamino-2,3-bis(2-aminoacetyl)-3-(1H-imidazol-5-yl)-4-oxopentanoic acid |
| SMILES | NCC(=O)C(C(=O)CN)(c1cnc[nH]1)[C@](N)(C(=O)O)C(=O)CN |
| InChI | InChI=1S/C12H18N6O5/c13-1-7(19)11(8(20)2-14,6-4-17-5-18-6)12(16,10(22)23)9(21)3-15/h4-5H,1-3,13-16H2,(H,17,18)(H,22,23)/t12-/m1/s1 |
| InChIKey | WOWCNKNHNSZIBL-GFCCVEGCSA-N |
| XLogP | -3.99 |
| TPSA | 221.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|